191-24-2 Benzo[ghi]perylene
상품명칭 |
Benzo[ghi]perylene |
영문 이름 |
Benzo[ghi]perylene; 1,12-Benzoperylene; Benzo[ghi]perylene (purity); benzo(g h i)perylene |
분자식 |
C22H12 |
분자량 |
276.3307 |
InChI |
InChI=1/C22H12/c1-3-13-7-9-15-11-12-16-10-8-14-4-2-6-18-17(5-1)19(13)21(15)22(16)20(14)18/h1-12H |
cas번호 |
191-24-2 |
EC번호 |
205-883-8 |
분자 구조 |
|
밀도 |
1.378g/cm3 |
녹는 점 |
276-280℃ |
비등점 |
501°C at 760 mmHg |
굴절 지수 |
2.009 |
인화점 |
247.2°C |
증기압 |
1.12E-09mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|